CHEBI:52641 – polyphosphoric acid
| ChEBI Name | polyphosphoric acid |
|---|---|
| ChEBI ID | CHEBI:52641 |
| Definition |
A polymerized phosphorus oxoacid of general formula HO[PO 2 OH] n H formed by condensation of orthophosphoric acid molecules and containing a backbone chain consisting of alternating P and O atoms covalently bonded together. |
•
29 nov. 2011
Besides, What is polyphosphoric?
Polyphosphoric acids are odourless, high viscousity liquids with strong hygroscopic properties. … For this reason acids with a concentration > 68% P2O5 are commonly known as polyphosphoric acids. Polyphosphoric acids are miscible with water, hydrolysing to orthophosphoric acid with the generation of heat.
Keeping this in mind, What is the structure of h4 p2 o7? Pyrophosphoric acid, also known as diphosphoric acid, is the inorganic compound with the formula H4P2O7 or, more descriptively, [(HO)2P(O)]2O. Colorless and odorless, it is soluble in water, diethyl ether, and ethyl alcohol. The anhydrous acid crystallizes in two polymorphs, which melt at 54.3 °C and 71.5 °C.
What is the difference between phosphoric acid and polyphosphoric acid?
The name phosphoric acid is the IUPAC name of orthophosphoric acid. The prefix –ortho is used to distinguish this acid from other phosphorous containing acids (polyphosphoric acids). There is no difference between orthophosphoric acid and phosphoric acid because both these names describe the same compound.
What is structure of h4p2o6?
Hypophosphoric acid is a mineral acid with the formula H4P2O6, with phosphorus in a formal oxidation state of +4. In the solid state it is present as the dihydrate, H4P2O6·2H2O. In hypophosphoric acid the phosphorus atoms are identical and joined directly with a P−P bond.
How do you handle polyphosphoric acid?
Keep in suitable, closed containers for disposal. Soak up with inert absorbent material. Do not get in eyes, on skin, or on clothing. Wear personal protective equipment/face protection.
What is H3PO4 in chemistry?
Phosphoric acid, also known as orthophosphoric acid or phosphoric(V) acid, is a weak acid with the chemical formula H3PO4.
What is the structure of h4 p2 o5?
Identification of Pyrophosphorous acid Chemical Compound
| Chemical Formula | H4O5P2 |
|---|---|
| Molecular Weight | 145.976284 g/mol |
| IUPAC Name | [(dihydroxyphosphanyl)oxy]phosphonous acid |
| SMILES String | OP(O)OP(O)O |
| InChI | InChI=1S/H4O5P2/c1-6(2)5-7(3)4/h1-4H |
What is the basic city of h4 p2 O 7?
The acid H4P2O7 contains four replaceable H−atoms. H4P2O7 is a tetrabasic acid. Hence the basicity of H4P2O7 is 4.
What is the structure of h2so5?
Peroxymonosulfuric acid
| PubChem CID | 2754594 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula |
H 2 O 5 S |
| Synonyms | Peroxymonosulfuric acid Caro’s acid 7722-86-3 (dioxido)hydroxidodioxidosulfur(.) hydroxy hydrogen sulfate More… |
| Molecular Weight | 114.08 |
Is phosphoric acid and orthophosphoric acid the same?
Phosphoric acid, also known as orthophosphoric acid or phosphoric(V) acid, is a weak acid with the chemical formula H3PO4.
What are the different types of phosphoric acid?
Cyclic phosphoric acids
-
Orthophosphoric acid. H
3
PO
4
-
Pyrophosphoric acid.
4
P.
2
O. … -
Tripolyphosphoric acid.
5
P.
3
O. … -
Tetrapolyphosphoric acid.
6
P.
4
O. … -
Trimetaphosphoric acid. H
3
P
3
O
9
-
Phosphoric anhydride. P
4
O
10
What is the structure of h3po5?
Peroxyphosphoric acid
| PubChem CID | 6326786 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula |
H 3 O 5 P |
| Synonyms | peroxyphosphoric acid phosphoroperoxoic acid CHEBI:29282 Peroxymonophosphate Peroxophosphoric acid More… |
| Molecular Weight | 113.99 |
What is the structure of h2s2o4?
Dithionous acid
| PubChem CID | 24490 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula |
H 2 S 2 O 4 or H 2 O 4 S 2 |
| Synonyms | dithionous acid dithionige Saeure hypodisulfurous acid 15959-26-9 CHEBI:29253 More… |
| Molecular Weight | 130.15 |
What is phosphoric ester?
The esters of phosphoric acid are especially important in biochemistry. A phosphoric acid molecule can form a monoalkyl, a dialkyl, or a trialkyl ester by reaction with one, two, or three molecules of an alcohol. Esters of pyrophosphoric acid and triphosphoric acid are also important in biochemistry.
What does phosphoric acid smell like?
Phosphoric acid
| Names | |
|---|---|
| Appearance | white solid |
|
Odor |
Odorless |
| Density |
1.6845 g⋅cm − 3 (25 °C, 85%), 1.834 g⋅cm − 3 (solid) |
| Melting point | 40–42.4 °C (104.0–108.3 °F; 313.1–315.5 K) |
How do you store phosphoric acid?
Store phosphoric acid in a cool, well-ventilated area protected from moisture. Keep away from incompatible substances such as oxidizing agents, metals, combustible materials, and alkalis. This chemical should be stored in a metallic or coated fiberboard container using a strong polyethylene inner package.
What does sulfuric acid look like?
Sulfuric acid is a colorless oily liquid. It is soluble in water with release of heat. … Sulfuric acid, spent appears as a black oily liquid.
What is the full form of H3PO4?
Orthophosphoric acid, H3PO4, is usually called simply phosphoric acid.
Is H3PO4 a base or acid?
So, Is H
3
PO
4
an acid or base? H
3
PO
4
is a
weak acid
because it undergoes partial dissociation on dissolving in water or aqueous solution and produces a low amount of hydrogen ion.
…
Is H3PO4 an acid or base? Weak vs Strong – Conjugate base.
| Name of Molecule |
Phosphoric acid |
|---|---|
|
Acidity (pK a ) | 2.14 |
What is the name of h4 p2 o6?
Hypodiphosphoric acid is a phosphorus oxoacid.
What is the oxidation state of h4 p2 of 5?
Oxidation states of P in H4P2O5, H4P2O6, H4P2O7, are respectively. +3, +5, +4.
What is the basicity of H3PO2?
H3PO2 has one ionizable –OH group, thus its basicity is 1.
What is the basic city of the Oxyacid?
Hence, we can say that basicity is the property exhibited by the H atoms that are attached to oxygen. As a result, phosphorous acid, H3PO3 is dibasic as it has two P-OH bonds. Similarly, phosphoric acid, H3PO4 is tribasic as it has three P-OH bonds.
What is the basicity of Hypophosphoric acid?
Therefore, the basicity of hypophosphorous acid is 1.